Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A498 | Purity: >98% |
 | |
| Chemical structure of Roscovitin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 186692-44-4 |
|---|---|
| Purity | >98% |
| Formula | C19H26N6O |
| Mol Weight | 354.4493 |
| CoA | CoA of Roscovitin |
| Smiles: | CCC(CO)NC1=NC(NCC2=CC=CC=C2)=C2N=CN(C(C)C)C2=N1 |
|---|
KEYWORDS: buy Roscovitin | Roscovitin supplier | purchase | cost | manufacturer | order | distributor | buy 186692-44-4 | 186692-44-4 supplier