Product Information:
| Cat. No.: EX-A3958 | Purity: >98% |
![]() | |
| Chemical structure of PROTAC BRD4 Degrader-5 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2409538-70-9 |
|---|---|
| Purity | >98% |
| Formula | C50H62ClN9O8S2 |
| Mol Weight | 1016.666 |
| CoA | CoA of PROTAC BRD4 Degrader-5 |
| Smiles: | O=C([C@H]1N(C([C@H](C(C)(C)C)NC(COCCOCCOCCNC(C[C@H]2C3=NN=C(C)N3C4=C(C(C)=C(C)S4)C(C5=CC=C(Cl)C=C5)=N2)=O)=O)=O)C[C@H](O)C1)N[C@H](C6=CC=C(C7=C(C)N=CS7)C=C6)C |
|---|
KEYWORDS: buy PROTAC BRD4 Degrader-5 | PROTAC BRD4 Degrader-5 supplier | purchase | cost | manufacturer | order | distributor | buy 2409538-70-9 | 2409538-70-9 supplier


Inhibitor Specialist
