Product Information:
| Cat. No.: EX-A11198 | Purity: >98% |
![]() | |
| Chemical structure of PKA-IN-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 179985-52-5 |
|---|---|
| Purity | >98% |
| Formula | C13H11N3O |
| Mol Weight | 225.2459 |
| CoA | CoA of PKA-IN-1 |
| Smiles: | CC(NC1=NC(C)=C(C#N)C2=C1C=CC=C2)=O |
|---|
KEYWORDS: buy PKA-IN-1 | PKA-IN-1 supplier | purchase | cost | manufacturer | order | distributor | buy 179985-52-5 | 179985-52-5 supplier


Inhibitor Specialist
