Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4031 | Purity: >98% |
 | |
| Chemical structure of PF-04745637 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1917294-46-2 |
|---|---|
| Purity | >98% |
| Formula | C27H32ClF3N2O2 |
| Mol Weight | 509.003 |
| CoA | CoA of PF-04745637 |
| Smiles: | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)NCC(CC3=CC=CC=C3)N4CCC(CC4)(C(F)(F)F)O |
|---|
KEYWORDS: buy PF-04745637 | PF-04745637 supplier | purchase | cost | manufacturer | order | distributor | buy 1917294-46-2 | 1917294-46-2 supplier