Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A664 | Purity: >98% |
 | |
| Chemical structure of Oprovin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 348575-88-2 |
|---|---|
| Purity | >98% |
| Formula | C15H13N3OS2 |
| Mol Weight | 315.413 |
| CoA | CoA of Oprovin |
| Smiles: | CC1=CC(\C=C2/SC(=S)NC2=O)=C(C)N1C1=CC=CN=C1 |
|---|
KEYWORDS: buy Oprovin | Oprovin supplier | purchase | cost | manufacturer | order | distributor | buy 348575-88-2 | 348575-88-2 supplier