Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A090 | Purity: >98% |
 | |
| Chemical structure of OC000459 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 851723-84-7 |
|---|---|
| Purity | >98% |
| Formula | C21H17FN2O2 |
| Mol Weight | 348.3703 |
| CoA | CoA of OC000459 |
| Smiles: | CC1=C(CC2=NC3=CC=CC=C3C=C2)C2=C(C=CC(F)=C2)N1CC(O)=O |
|---|
KEYWORDS: buy OC000459 | OC000459 supplier | purchase | cost | manufacturer | order | distributor | buy 851723-84-7 | 851723-84-7 supplier