Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3515 | Purity: >98% |
 | |
| Chemical structure of O151 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 304478-23-7 |
|---|---|
| Purity | >98% |
| Formula | C13H15BrN2O |
| Mol Weight | 295.175 |
| CoA | CoA of O151 |
| Smiles: | BrC1=CC=C(C(N/N=C2CCCCC/2)=O)C=C1 |
|---|
KEYWORDS: buy O151 | O151 supplier | purchase | cost | manufacturer | order | distributor | buy 304478-23-7 | 304478-23-7 supplier