Product Information:
| Cat. No.: EX-A15832 | Purity: >98% |
![]() | |
| Chemical structure of NGI-235 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2763063-40-5 |
|---|---|
| Purity | >98% |
| Formula | C25H30N4O3S2 |
| Mol Weight | 498.661 |
| Appearance | Light yellow to yellow solid |
| Solubility | soluble in DMSO |
| Storage | 4℃, sealed storage, away from moisture, 2 years |
| Reference: | |
| CoA | CoA of NGI-235 |
| Smiles: | O=C(C1=CC(S(=O)(N(CC2=CC=CC=C2)C)=O)=CC=C1N(CC3CC3)C)NC4=NC=C(CC)S4 |
|---|
KEYWORDS: buy NGI-235 | NGI-235 supplier | purchase | cost | manufacturer | order | distributor | buy 2763063-40-5 | 2763063-40-5 supplier


Inhibitor Specialist
