Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11858 | Purity: >98% |
 | |
| Chemical structure of Mal-amido-(CH2COOH)2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 207613-14-7 |
|---|---|
| Purity | >98% |
| Formula | C11H12N2O7 |
| Mol Weight | 284.2222 |
| CoA | CoA of Mal-amido-(CH2COOH)2 |
| Smiles: | C1=CC(=O)N(C1=O)CCC(=O)N(CC(=O)O)CC(=O)O |
|---|
KEYWORDS: buy Mal-amido-(CH2COOH)2 | Mal-amido-(CH2COOH)2 supplier | purchase | cost | manufacturer | order | distributor | buy 207613-14-7 | 207613-14-7 supplier