Product Information:
| Cat. No.: EX-A15250 | Purity: >98% |
![]() | |
| Chemical structure of LOE 908 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 143482-60-4 |
|---|---|
| Purity | >98% |
| Formula | C41H49ClN2O9 |
| Mol Weight | 749.289 |
| Reference: | |
| CoA | CoA of LOE 908 hydrochloride |
| Smiles: | COC1=C(C(=C(C=C1)CCN(CCC2=C(C(=C(C=C2)OC)OC)OC)C(=O)C(C3=CC=CC=C3)C4=NCCC5=CC(=C(C=C54)OC)OC)OC)OC.Cl |
|---|
KEYWORDS: buy LOE 908 hydrochloride | LOE 908 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 143482-60-4 | 143482-60-4 supplier


Inhibitor Specialist
