Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A091 | Purity: >98% |
 | |
| Chemical structure of HQL-79 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 162641-16-9 |
|---|---|
| Purity | >98% |
| Formula | C22H27N5O |
| Mol Weight | 377.4827 |
| CoA | CoA of HQL-79 |
| Smiles: | C(CN1CCC(CC1)OC(C1=CC=CC=C1)C1=CC=CC=C1)CC1=NN=NN1 |
|---|
KEYWORDS: buy HQL-79 | HQL-79 supplier | purchase | cost | manufacturer | order | distributor | buy 162641-16-9 | 162641-16-9 supplier