Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1159 | Purity: >98% |
 | |
| Chemical structure of HMN-176 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 173529-10-7 |
|---|---|
| Purity | >98% |
| Formula | C20H18N2O4S |
| Mol Weight | 382.433 |
| CoA | CoA of HMN-176 |
| Smiles: | COC1=CC=C(C=C1)S(=O)(=O)\N=C1/C=CC=C/C/1=C\C=C1/C=CN(O)C=C/1 |
|---|
KEYWORDS: buy HMN-176 | HMN-176 supplier | purchase | cost | manufacturer | order | distributor | buy 173529-10-7 | 173529-10-7 supplier