Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2393 | Purity: >98% |
 | |
| Chemical structure of HC-030031 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 349085-38-7 |
|---|---|
| Purity | >98% |
| Formula | C18H21N5O3 |
| Mol Weight | 355.391 |
| CoA | CoA of HC-030031 |
| Smiles: | CC(C)C1=CC=C(NC(=O)CN2C=NC3=C2C(=O)N(C)C(=O)N3C)C=C1 |
|---|
KEYWORDS: buy HC-030031 | HC-030031 supplier | purchase | cost | manufacturer | order | distributor | buy 349085-38-7 | 349085-38-7 supplier