Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11987 | Purity: >98% |
 | |
| Chemical structure of Glutamic γ-monohydroxamate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Glutamic gamma-monohydroxamate |
|---|---|
| CAS No. | 805179-13-9 |
| Purity | >98% |
| Formula | C5H10N2O4 |
| Mol Weight | 162.1439 |
| CoA | CoA of Glutamic γ-monohydroxamate |
| Smiles: | [C@H](CCC(N)=O)(C(O)=O)NO |
|---|
KEYWORDS: buy Glutamic γ-monohydroxamate | Glutamic γ-monohydroxamate supplier | purchase | cost | manufacturer | order | distributor | buy 805179-13-9 | 805179-13-9 supplier