Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2233 | Purity: >98% |
 | |
| Chemical structure of GSK650394 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 890842-28-1 |
|---|---|
| Purity | >98% |
| Formula | C25H22N2O2 |
| Mol Weight | 382.4544 |
| CoA | CoA of GSK650394 |
| Smiles: | OC(=O)C1=C(C=C(C=C1)C1=CNC2=NC=C(C=C12)C1=CC=CC=C1)C1CCCC1 |
|---|
KEYWORDS: buy GSK650394 | GSK650394 supplier | purchase | cost | manufacturer | order | distributor | buy 890842-28-1 | 890842-28-1 supplier