Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2336 | Purity: >98% |
 | |
| Chemical structure of GSK-2881078 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1539314-06-1 |
|---|---|
| Purity | >98% |
| Formula | C14H13F3N2O2S |
| Mol Weight | 330.325 |
| CoA | CoA of GSK-2881078 |
| Smiles: | C[C@H](CS(C)(=O)=O)N1C=CC2=C1C=CC(C#N)=C2C(F)(F)F |
|---|
KEYWORDS: buy GSK-2881078 | GSK-2881078 supplier | purchase | cost | manufacturer | order | distributor | buy 1539314-06-1 | 1539314-06-1 supplier