Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13581 | Purity: >98% |
 | |
| Chemical structure of GPP78 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | GPP 78 hydrochloride |
|---|---|
| Purity | >98% |
| Formula | C27H30ClN5O |
| Mol Weight | 476.013 |
| CoA | CoA of GPP78 hydrochloride |
| Smiles: | O=C(NC1=CC=CC=C1C2=CC=CC=C2)CCCCCCCN3C=C(C4=CN=CC=C4)N=N3.Cl |
|---|
KEYWORDS: buy GPP78 hydrochloride | GPP78 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy | supplier