Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11843 | Purity: >98% |
 | |
| Chemical structure of GGFG-Eribulin |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2841688-66-0 |
|---|---|
| Purity | >98% |
| Formula | C55H77N5O15 |
| Mol Weight | 1048.2244 |
| CoA | CoA of GGFG-Eribulin |
| Smiles: | C[C@@H]1C[C@@H]2CC[C@H]3C(=C)C[C@@H](O3)CC[C@]45C[C@@H]6[C@H](O4)[C@H]7[C@@H](O6)[C@@H](O5)[C@@H]8[C@@H](O7)CC[C@@H](O8)CC(=O)C[C@H]9[C@H](C[C@H](C1=C)O2)O[C@@H]([C@@H]9OC)C[C@@H](CNC(=O)CNC(=O)[C@H](CC1=CC=CC=C1)NC(=O)CNC(=O)CN)O |
|---|
KEYWORDS: buy GGFG-Eribulin | GGFG-Eribulin supplier | purchase | cost | manufacturer | order | distributor | buy 2841688-66-0 | 2841688-66-0 supplier