Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A339 | Purity: >98% |
 | |
| Chemical structure of GANT-61 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | NSC 136476 |
|---|---|
| CAS No. | 500579-04-4 |
| Purity | >98% |
| Formula | C27H35N5 |
| Mol Weight | 429.6003 |
| CoA | CoA of GANT-61 |
| Smiles: | CN(C)C1=CC=CC=C1CN1CCCN(CC2=C(C=CC=C2)N(C)C)C1C1=CC=NC=C1 |
|---|
KEYWORDS: buy GANT-61 | GANT-61 supplier | purchase | cost | manufacturer | order | distributor | buy 500579-04-4 | 500579-04-4 supplier