Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12126H | Purity: |
 | |
| Chemical structure of Fmoc-N-Me-3-(4-py)-L-Ala |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Fmoc-N-Me-3-(4-py)-L-Ala, a synthetic molecule, finds widespread use in the synthesis of peptides and proteins. Owing to its crucial role as a fundamental building block in solid-phase peptide synthesis, it has emerged as a potent weapon in the battle aga |
|---|---|
| CAS No. | 2381854-90-4 |
| Formula | C24H22N2O4 |
| Mol Weight | 402.4425 |
| CoA | CoA of Fmoc-N-Me-3-(4-py)-L-Ala |
| Smiles: | C(OC(N([C@@H](CC=1C=CN=CC1)C(O)=O)C)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3 |
|---|
KEYWORDS: buy Fmoc-N-Me-3-(4-py)-L-Ala | Fmoc-N-Me-3-(4-py)-L-Ala supplier | purchase | cost | manufacturer | order | distributor | buy 2381854-90-4 | 2381854-90-4 supplier