Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12126E | Purity: >98% |
 | |
| Chemical structure of Fmoc-Dha-OH |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Fmoc-Dha-OH, a pivotal intermediate, is used for synthesizing a plethora of biologically active compounds encompassing antimicrobial peptides, dipeptidyl peptidase IV inhibitors, and enzyme inhibitors. Researchers have employed it to fabricate Fmoc-Dha-OH |
|---|---|
| CAS No. | 261522-33-2 |
| Purity | >98% |
| Formula | C18H15NO4 |
| Mol Weight | 309.316 |
| CoA | CoA of Fmoc-Dha-OH |
| Smiles: | O=C(O)C(=C)NC(=O)OCC1C=2C=CC=CC2C=3C=CC=CC31 |
|---|
KEYWORDS: buy Fmoc-Dha-OH | Fmoc-Dha-OH supplier | purchase | cost | manufacturer | order | distributor | buy 261522-33-2 | 261522-33-2 supplier