Eyeliss
|
|
|
| Cat. No.: EX-A12122 | Purity: |
|  |
| Chemical structure of Eyeliss |
For research only, Do not use for Human!
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Synonyms | Eyeliss is a cosmetic indegredient that has been used to relieve puffiness under eye bags and reduce dark circles beneath the eyes. |
|---|
| CAS No. | 24587-37-9 |
|---|
| Formula | C16H21N3O3 |
|---|
| Mol Weight | 303.3562 |
|---|
| |
|---|
| | |
|---|
| CoA | CoA of Eyeliss |
|---|
| Smiles: | C([C@H](NC([C@H](C(C)C)N)=O)C(O)=O)C=1C=2C(NC1)=CC=CC2 |
|---|
KEYWORDS: buy Eyeliss | Eyeliss supplier | purchase | cost | manufacturer | order | distributor | buy 24587-37-9 | 24587-37-9 supplier
Inhibitor Specialist 