Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A888 | Purity: >98% |
 | |
| Chemical structure of Ethaboxam |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 162650-77-3 |
|---|---|
| Purity | >98% |
| Formula | C14H16N4OS2 |
| Mol Weight | 320.433 |
| CoA | CoA of Ethaboxam |
| Smiles: | CCNC1=NC(CC)=C(S1)C(=O)NC(C#N)C1=CC=CS1 |
|---|
KEYWORDS: buy Ethaboxam | Ethaboxam supplier | purchase | cost | manufacturer | order | distributor | buy 162650-77-3 | 162650-77-3 supplier