Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A803 | Purity: >98% |
 | |
| Chemical structure of EXP-3174 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 124750-92-1 |
|---|---|
| Purity | >98% |
| Formula | C22H21ClN6O2 |
| Mol Weight | 436.894 |
| CoA | CoA of EXP-3174 |
| Smiles: | CCCCC1=NC(Cl)=C(N1CC1=CC=C(C=C1)C1=CC=CC=C1C1=NNN=N1)C(O)=O |
|---|
KEYWORDS: buy EXP-3174 | EXP-3174 supplier | purchase | cost | manufacturer | order | distributor | buy 124750-92-1 | 124750-92-1 supplier