Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4972 | Purity: >98% |
 | |
| Chemical structure of EC23 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 104561-41-3 |
|---|---|
| Purity | >98% |
| Formula | C23H24O2 |
| Mol Weight | 332.4355 |
| CoA | CoA of EC23 |
| Smiles: | CC1(CCC(C2=C1C=CC(=C2)C#CC3=CC=C(C=C3)C(=O)O)(C)C)C |
|---|
KEYWORDS: buy EC23 | EC23 supplier | purchase | cost | manufacturer | order | distributor | buy 104561-41-3 | 104561-41-3 supplier