Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10698 | Purity: >98% |
 | |
| Chemical structure of Diamthazole hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Dimazole hydrochloride |
|---|---|
| CAS No. | 17140-69-1 |
| Purity | >98% |
| Formula | C15H24ClN3OS |
| Mol Weight | 329.889 |
| CoA | CoA of Diamthazole hydrochloride |
| Smiles: | CN(C)C1=NC2=CC=C(OCCN(CC)CC)C=C2S1.[H]Cl |
|---|
KEYWORDS: buy Diamthazole hydrochloride | Diamthazole hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 17140-69-1 | 17140-69-1 supplier