Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12377 | Purity: >98% |
 | |
| Chemical structure of DHPG |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | (RS)-3,5-DHPG |
|---|---|
| CAS No. | 146255-66-5 |
| Purity | >98% |
| Formula | C8H9NO4 |
| Mol Weight | 183.1614 |
| CoA | CoA of DHPG |
| Smiles: | O=C(O)C(N)C=1C=C(O)C=C(O)C1 |
|---|
KEYWORDS: buy DHPG | DHPG supplier | purchase | cost | manufacturer | order | distributor | buy 146255-66-5 | 146255-66-5 supplier