Product Information:
| Cat. No.: EX-A11241 | Purity: >98% |
![]() | |
| Chemical structure of Carmoterol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 147568-66-9 |
|---|---|
| Purity | >98% |
| Formula | C21H24N2O4 |
| Mol Weight | 368.4263 |
| CoA | CoA of Carmoterol |
| Smiles: | O=C1NC2=C(C([C@@H](O)CN[C@H](C)CC3=CC=C(OC)C=C3)=CC=C2O)C=C1 |
|---|
KEYWORDS: buy Carmoterol | Carmoterol supplier | purchase | cost | manufacturer | order | distributor | buy 147568-66-9 | 147568-66-9 supplier


Inhibitor Specialist
