Product Information:
| Cat. No.: EX-A2758 | Purity: >98% |
![]() | |
| Chemical structure of Canagliflozin Impurity 10 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1672658-93-3 |
|---|---|
| Purity | >98% |
| Formula | C24H25FO6S |
| Mol Weight | 460.515 |
| CoA | CoA of Canagliflozin Impurity 10 |
| Smiles: | CC1=CC=C(C=C1CC1=CC=C(S1)C1=CC=C(F)C=C1)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
|---|
KEYWORDS: buy Canagliflozin Impurity 10 | Canagliflozin Impurity 10 supplier | purchase | cost | manufacturer | order | distributor | buy 1672658-93-3 | 1672658-93-3 supplier


Inhibitor Specialist
