Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11293 | Purity: >98% |
 | |
| Chemical structure of CHF-6523 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2500579-21-3 |
|---|---|
| Purity | >98% |
| Formula | C33H32N8O3 |
| Mol Weight | 588.659 |
| CoA | CoA of CHF-6523 |
| Smiles: | [C@H](C)(C1=C(C=2C(C(=O)O1)=CC=CC2)C3=CC(CN4CCN(C)CC4)=CC=C3)N5C=6C(C(=N5)C=7C=C(O)C=NC7)=C(N)N=CN6 |
|---|
KEYWORDS: buy CHF-6523 | CHF-6523 supplier | purchase | cost | manufacturer | order | distributor | buy 2500579-21-3 | 2500579-21-3 supplier