Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2036 | Purity: >98% |
 | |
| Chemical structure of BS-181 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1397219-81-6 |
|---|---|
| Purity | >98% |
| Formula | C22H33ClN6 |
| Mol Weight | 416.991 |
| CoA | CoA of BS-181 hydrochloride |
| Smiles: | Cl[H].CC(C)C1=C2N=C(NCCCCCCN)C=C(NCC3=CC=CC=C3)N2N=C1 |
|---|
KEYWORDS: buy BS-181 hydrochloride | BS-181 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1397219-81-6 | 1397219-81-6 supplier