Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3763 | Purity: >98% |
 | |
| Chemical structure of BRITE-338733 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 503105-88-2 |
|---|---|
| Purity | >98% |
| Formula | C27H35N3O2 |
| Mol Weight | 433.5857 |
| CoA | CoA of BRITE-338733 |
| Smiles: | OC1=CC=C(C)C=C1C2=NC(NC3CC(C)(C)NC(C)(C)C3)=CC(C4=CC=C(CC)O4)=C2 |
|---|
KEYWORDS: buy BRITE-338733 | BRITE-338733 supplier | purchase | cost | manufacturer | order | distributor | buy 503105-88-2 | 503105-88-2 supplier