Product Information:
| Cat. No.: EX-A14471 | Purity: >98% |
![]() | |
| Chemical structure of BMS 961 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 185629-22-5 |
|---|---|
| Purity | >98% |
| Formula | C23H26FNO4 |
| Mol Weight | 399.4552 |
| Reference: | |
| CoA | CoA of BMS 961 |
| Smiles: | CC1(CCC(C2=C1C=CC(=C2)C(C(=O)NC3=C(C=C(C=C3)C(=O)O)F)O)(C)C)C |
|---|
KEYWORDS: buy BMS 961 | BMS 961 supplier | purchase | cost | manufacturer | order | distributor | buy 185629-22-5 | 185629-22-5 supplier


Inhibitor Specialist
