Product Information:
| Cat. No.: EX-A12063 | Purity: >98% |
![]() | |
| Chemical structure of BGSN3 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2996069-91-9 |
|---|---|
| Purity | >98% |
| Formula | C17H19N9O2 |
| Mol Weight | 381.3919 |
| CoA | CoA of BGSN3 |
| Smiles: | [N-]=[N+]=NCCCC(=O)NCC1=CC=C(C=C1)COC2=NC(=NC=3N=CNC32)N |
|---|
KEYWORDS: buy BGSN3 | BGSN3 supplier | purchase | cost | manufacturer | order | distributor | buy 2996069-91-9 | 2996069-91-9 supplier


Inhibitor Specialist
