Product Information:
| Cat. No.: EX-A10715 | Purity: >98% | 
|  | |
| Chemical structure of Acoziborole | 
| Size | Unit Price (US$) | Stock | Quantity | Order | 
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 | 
| Discount Request | 
| Synonyms | SCYX-7158 | 
|---|---|
| Synonyms 2 | AN5568 | 
| CAS No. | 1266084-51-8 | 
| Purity | >98% | 
| Formula | C17H14BF4NO3 | 
| Mol Weight | 367.103 | 
| Appearance | White to off-white solid | 
| Solubility | Soluble in DMSO | 
| Shelf Life | >3 years if stored properly | 
| Storage | Powder 4℃, 2 years; In solvent -20℃ 1 month; | 
| Shipping | Shipped under ambient temperature as non-hazardous chemical. This product is stable enough for a few weeks during ordinary shipping and time spent in Customs. | 
| Reference: | |
| CoA | CoA of Acoziborole | 
| Smiles: | O=C(NC1=CC=C2C(C)(C)OB(O)C2=C1)C3=CC=C(F)C=C3C(F)(F)F | 
|---|
KEYWORDS: buy Acoziborole | Acoziborole supplier | purchase | cost | manufacturer | order | distributor | buy 1266084-51-8 | 1266084-51-8 supplier





 
 
 
 
 
 
 
 
 
  Inhibitor Specialist
  Inhibitor Specialist 