Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A824 | Purity: >98% |
 | |
| Chemical structure of AZD5104 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1421373-98-9 |
|---|---|
| Purity | >98% |
| Formula | C27H31N7O2 |
| Mol Weight | 485.5807 |
| CoA | CoA of AZD5104 |
| Smiles: | COC1=C(NC2=NC(=CC=N2)C2=CNC3=CC=CC=C23)C=C(NC(=O)C=C)C(=C1)N(C)CCN(C)C |
|---|
KEYWORDS: buy AZD5104 | AZD5104 supplier | purchase | cost | manufacturer | order | distributor | buy 1421373-98-9 | 1421373-98-9 supplier