Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11981 | Purity: >98% |
 | |
| Chemical structure of ASC-69 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1216665-50-7 |
|---|---|
| Purity | >98% |
| Formula | C19H19N7 |
| Mol Weight | 345.4011 |
| CoA | CoA of ASC-69 |
| Smiles: | CC1=CC(=NC(=N1)NC2=CC=C(C=C2)CC#N)NC3=NNC(=C3)C4CC4 |
|---|
KEYWORDS: buy ASC-69 | ASC-69 supplier | purchase | cost | manufacturer | order | distributor | buy 1216665-50-7 | 1216665-50-7 supplier