Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A696 | Purity: >98% |
 | |
| Chemical structure of AM251 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 183232-66-8 |
|---|---|
| Purity | >98% |
| Formula | C22H21Cl2IN4O |
| Mol Weight | 555.239 |
| CoA | CoA of AM251 |
| Smiles: | CC1=C(N(N=C1C(=O)NN1CCCCC1)C1=CC=C(Cl)C=C1Cl)C1=CC=C(I)C=C1 |
|---|
KEYWORDS: buy AM251 | AM251 supplier | purchase | cost | manufacturer | order | distributor | buy 183232-66-8 | 183232-66-8 supplier