Product Information:
| Cat. No.: EX-A14517 | Purity: >98% |
![]() | |
| Chemical structure of AC-265347 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1253901-26-6 |
|---|---|
| Purity | >98% |
| Formula | C17H17NOS |
| Mol Weight | 283.388 |
| Reference: | |
| CoA | CoA of AC-265347 |
| Smiles: | CC1=CC(=C(C=C1)C(C)(C2=NC3=CC=CC=C3S2)O)C |
|---|
KEYWORDS: buy AC-265347 | AC-265347 supplier | purchase | cost | manufacturer | order | distributor | buy 1253901-26-6 | 1253901-26-6 supplier


Inhibitor Specialist
