Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13461W | Purity: >98% |
 | |
| Chemical structure of 1,4,7,10-Tetramethyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 871327-08-1 |
|---|---|
| Purity | >98% |
| Formula | C20H36N4O8 |
| Mol Weight | 460.5218 |
| CoA | CoA of 1,4,7,10-Tetramethyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate |
| Smiles: | O=C(OC)CN1CCN(CC(=O)OC)CCN(CC(=O)OC)CCN(CC(=O)OC)CC1 |
|---|
KEYWORDS: buy 1,4,7,10-Tetramethyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate | 1,4,7,10-Tetramethyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate supplier | purchase | cost | manufacturer | order | distributor | buy 871327-08-1 | 871327-08-1 supplier