Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12776D | Purity: >98% |
 | |
| Chemical structure of 7-fluoro-1H-indazole-3-carboxylic acid |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2839511-89-4 |
|---|---|
| Purity | >98% |
| Formula | C12H19F3N2O2 |
| Mol Weight | 280.2867 |
| CoA | CoA of 7-fluoro-1H-indazole-3-carboxylic acid |
| Smiles: | O=C(OC(C)(C)C)NCC12CNCC2(C1)C(F)(F)F |
|---|
KEYWORDS: buy 7-fluoro-1H-indazole-3-carboxylic acid | 7-fluoro-1H-indazole-3-carboxylic acid supplier | purchase | cost | manufacturer | order | distributor | buy 2839511-89-4 | 2839511-89-4 supplier