Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11734 | Purity: >97% |
 | |
| Chemical structure of 6-OKF532 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 916753-60-1 |
|---|---|
| Purity | >97% |
| Formula | C34H33N3O11S2 |
| Mol Weight | 723.769 |
| CoA | CoA of 6-OKF532 |
| Smiles: | O=C(ON1C(=O)CCC1=O)C2=CC=CC(=C2)C=3C=4C=C5C(NC(C)C5(C)C)=C(C4[O+]=C6C3C=C7C(NC(C)C7(C)C)=C6S(=O)(=O)O)S(=O)(=O)[O-] |
|---|
KEYWORDS: buy 6-OKF532 | 6-OKF532 supplier | purchase | cost | manufacturer | order | distributor | buy 916753-60-1 | 916753-60-1 supplier