Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16201 | Purity: >98% |
 | |
| Chemical structure of 522-054 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1243273-19-9 |
|---|---|
| Purity | >98% |
| Formula | C21H15F2N5 |
| Mol Weight | 375.3741 |
| CoA | CoA of 522-054 |
| Smiles: | FC=1C=CC(F)=C(C1)C2=NN=C3C=CC(=NN32)C=4C=CC5=C(C=CN5CC)C4 |
|---|
KEYWORDS: buy 522-054 | 522-054 supplier | purchase | cost | manufacturer | order | distributor | buy 1243273-19-9 | 1243273-19-9 supplier