Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A542 | Purity: >98% |
 | |
| Chemical structure of 4SC-201 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Resminostat |
|---|---|
| CAS No. | 864814-88-0 |
| Purity | >98% |
| Formula | C16H19N3O4S |
| Mol Weight | 349.405 |
| CoA | CoA of 4SC-201 |
| Smiles: | CN(C)CC1=CC=C(C=C1)S(=O)(=O)N1C=CC(\C=C\C(=O)NO)=C1 |
|---|
KEYWORDS: buy 4SC-201 | 4SC-201 supplier | purchase | cost | manufacturer | order | distributor | buy 864814-88-0 | 864814-88-0 supplier