Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3043 | Purity: >98% |
 | |
| Chemical structure of 4-(2-Benzothiazolyl)aniline |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 6278-73-5 |
|---|---|
| Purity | >98% |
| Formula | C13H10N2S |
| Mol Weight | 226.297 |
| CoA | CoA of 4-(2-Benzothiazolyl)aniline |
| Smiles: | NC1=CC=C(C=C1)C1=NC2=CC=CC=C2S1 |
|---|
KEYWORDS: buy 4-(2-Benzothiazolyl)aniline | 4-(2-Benzothiazolyl)aniline supplier | purchase | cost | manufacturer | order | distributor | buy 6278-73-5 | 6278-73-5 supplier