Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17547F | Purity: >98% |
 | |
| Chemical structure of (3S,5R,6R)-Bupropion Impurity |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2133460-43-0 |
|---|---|
| Purity | >98% |
| Formula | C12H14ClNO3S |
| Mol Weight | 287.762 |
| CoA | CoA of (3S,5R,6R)-Bupropion Impurity |
| Smiles: | O[C@]1([C@@H](C)N[C@@H](C(O)=O)CS1)C2=CC(Cl)=CC=C2 |
|---|
KEYWORDS: buy (3S,5R,6R)-Bupropion Impurity | (3S,5R,6R)-Bupropion Impurity supplier | purchase | cost | manufacturer | order | distributor | buy 2133460-43-0 | 2133460-43-0 supplier