Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12847 | Purity: >95% |
 | |
| Chemical structure of γ-Oxo-9H-fluorene-3-butanoic acid |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 339562-33-3 |
|---|---|
| Purity | >95% |
| Formula | C17H14O3 |
| Mol Weight | 266.2913 |
| CoA | CoA of γ-Oxo-9H-fluorene-3-butanoic acid |
| Smiles: | O=C(O)CCC(=O)C1=CC=C2C(=C1)C=3C=CC=CC3C2 |
|---|
KEYWORDS: buy γ-Oxo-9H-fluorene-3-butanoic acid | γ-Oxo-9H-fluorene-3-butanoic acid supplier | purchase | cost | manufacturer | order | distributor | buy 339562-33-3 | 339562-33-3 supplier