Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16883 | Purity: >98% |
 | |
| Chemical structure of |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3084148-92-2 |
|---|---|
| Purity | >98% |
| Formula | C42H53N8O6PS |
| Mol Weight | 828.959 |
| CoA | CoA of |
| Smiles: | C(CN(CC1=CC=CC=C1)CC2=CC=CC=C2)(=O)N3C[C@H](C[C@H]3C(NCCCCCCN)=O)N4C=C(COC5=CC=C(C(NCC6=CC=CS6)P(=O)(O)O)C=C5)N=N4 |
|---|
KEYWORDS: buy | supplier | purchase | cost | manufacturer | order | distributor | buy 3084148-92-2 | 3084148-92-2 supplier