Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16736 | Purity: >98% |
 | |
| Chemical structure of |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3046285-69-9 |
|---|---|
| Purity | >98% |
| Formula | C20H16FN5O2 |
| Mol Weight | 377.3717 |
| CoA | CoA of |
| Smiles: | C(NC1=CC(=CC=C1C)C=2N=C(ON2)[C@@H]3[C@H](F)C3)(=O)C=4N5C(=NC4)C=CC=C5 |
|---|
KEYWORDS: buy | supplier | purchase | cost | manufacturer | order | distributor | buy 3046285-69-9 | 3046285-69-9 supplier