Product Information:
| Cat. No.: EX-A15703 | Purity: >98% |
![]() | |
| Chemical structure of 1H-Pyrrolo[3,4-c]pyridin-1-one, 2,3-dihydro-4-(3-methoxyphenyl)-2-phenyl- |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2766971-12-2 |
|---|---|
| Purity | >98% |
| Formula | C20H16N2O2 |
| Mol Weight | 316.3532 |
| CoA | CoA of 1H-Pyrrolo[3,4-c]pyridin-1-one, 2,3-dihydro-4-(3-methoxyphenyl)-2-phenyl- |
| Smiles: | O=C1C=2C=CN=C(C=3C=CC=C(OC)C3)C2CN1C=4C=CC=CC4 |
|---|
KEYWORDS: buy 1H-Pyrrolo[3,4-c]pyridin-1-one, 2,3-dihydro-4-(3-methoxyphenyl)-2-phenyl- | 1H-Pyrrolo[3,4-c]pyridin-1-one, 2,3-dihydro-4-(3-methoxyphenyl)-2-phenyl- supplier | purchase | cost | manufacturer | order | distributor | buy 2766971-12-2 | 2766971-12-2 supplier


Inhibitor Specialist
